About N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine
N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine (PubChem CID 167909104) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine.
Molecular Properties
| Compound Name | N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
| PubChem CID | 167909104 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
| SMILES | CCNC1(c2nc(C)no2)CCOCC1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-11-10(4-6-14-7-5-10)9-12-8(2)13-15-9/h11H,3-7H2,1-2H3 |
| InChIKey | XIUTWHUPGNEGQE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine?
The IUPAC name of N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine (CID 167909104) is N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine.
What is the SMILES notation for N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine?
The canonical SMILES for N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine is CCNC1(c2nc(C)no2)CCOCC1.
What is the InChIKey of N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine?
The InChIKey is XIUTWHUPGNEGQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-3-11-10(4-6-14-7-5-10)9-12-8(2)13-15-9/h11H,3-7H2,1-2H3.
What are the key properties of N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine?
N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine has a molecular weight of 211.26 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)oxan-4-amine is sourced from PubChem (CID 167909104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).