C13H14N4O4 — CID 167909307
methyl 2-[[3-(5-methyl-1H-1,2,4-triazol-3-yl)benzoyl]amino]oxyacetate (PubChem CID 167909307) has the molecular formula C13H14N4O4 and a molecular weight of 290.28 g/mol. Its IUPAC name is methyl 2-[[3-(5-methyl-1H-1,2,4-triazol-3-yl)benzoyl]amino]oxyacetate.
| Compound Name | methyl 2-[[3-(5-methyl-1H-1,2,4-triazol-3-yl)benzoyl]amino]oxyacetate |
|---|---|
| PubChem CID | 167909307 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | methyl 2-[[3-(5-methyl-1H-1,2,4-triazol-3-yl)benzoyl]amino]oxyacetate |
| SMILES | COC(=O)CONC(=O)c1cccc(-c2n[nH]c(C)n2)c1 |
| InChI | InChI=1S/C13H14N4O4/c1-8-14-12(16-15-8)9-4-3-5-10(6-9)13(19)17-21-7-11(18)20-2/h3-6H,7H2,1-2H3,(H,17,19)(H,14,15,16) |
| InChIKey | YSJYRJKOVHBVRR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|