C18H20FNO4 — CID 167909565
5-[[4-[(2-fluorophenyl)methoxy]piperidin-1-yl]methyl]furan-2-carboxylic acid (PubChem CID 167909565) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is 5-[[4-[(2-fluorophenyl)methoxy]piperidin-1-yl]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(2-fluorophenyl)methoxy]piperidin-1-yl]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 167909565 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 5-[[4-[(2-fluorophenyl)methoxy]piperidin-1-yl]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2CCC(OCc3ccccc3F)CC2)o1 |
| InChI | InChI=1S/C18H20FNO4/c19-16-4-2-1-3-13(16)12-23-14-7-9-20(10-8-14)11-15-5-6-17(24-15)18(21)22/h1-6,14H,7-12H2,(H,21,22) |
| InChIKey | XOENEKKIKUIRLF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |