C16H17FN4O — CID 167910575
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-(1-methyltriazol-4-yl)ethanamine (PubChem CID 167910575) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 167910575 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-1-(1-methyltriazol-4-yl)ethanamine |
| SMILES | CC(NCc1ccc(-c2ccc(F)cc2)o1)c1cn(C)nn1 |
| InChI | InChI=1S/C16H17FN4O/c1-11(15-10-21(2)20-19-15)18-9-14-7-8-16(22-14)12-3-5-13(17)6-4-12/h3-8,10-11,18H,9H2,1-2H3 |
| InChIKey | GNWGCSYFAOLKGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |