C20H24N2O3 — CID 167910990
[1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxypyrrolidin-2-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 167910990) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxypyrrolidin-2-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | [1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxypyrrolidin-2-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 167910990 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxypyrrolidin-2-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1CC(O)CN1C(=O)c1ccc2c(c1)CCC2)N1CC=CCC1 |
| InChI | InChI=1S/C20H24N2O3/c23-17-12-18(20(25)21-9-2-1-3-10-21)22(13-17)19(24)16-8-7-14-5-4-6-15(14)11-16/h1-2,7-8,11,17-18,23H,3-6,9-10,12-13H2 |
| InChIKey | QRCQAPOEHNBQFU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|