About methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate
methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate (PubChem CID 167911140) has the molecular formula C14H15F3N4O3
and a molecular weight of 344.29 g/mol. Its IUPAC name is methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate |
| PubChem CID | 167911140 |
| Molecular Formula | C14H15F3N4O3 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate |
| SMILES | COC(=O)Cc1cn(Cc2nccc(OCC(F)(F)F)c2C)nn1 |
| InChI | InChI=1S/C14H15F3N4O3/c1-9-11(18-4-3-12(9)24-8-14(15,16)17)7-21-6-10(19-20-21)5-13(22)23-2/h3-4,6H,5,7-8H2,1-2H3 |
| InChIKey | QKLCXAWLHXKBJU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate?
The IUPAC name of methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate (CID 167911140) is methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate?
The canonical SMILES for methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate is COC(=O)Cc1cn(Cc2nccc(OCC(F)(F)F)c2C)nn1.
What is the InChIKey of methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate?
The InChIKey is QKLCXAWLHXKBJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N4O3/c1-9-11(18-4-3-12(9)24-8-14(15,16)17)7-21-6-10(19-20-21)5-13(22)23-2/h3-4,6H,5,7-8H2,1-2H3.
What are the key properties of methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate?
methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate has a molecular weight of 344.29 g/mol, XLogP of 1.69, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[[3-methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]triazol-4-yl]acetate is sourced from PubChem (CID 167911140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).