C13H19F3N2O — CID 16791138
N,N-diethyl-1-[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine (PubChem CID 16791138) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is N,N-diethyl-1-[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine.
| Compound Name | N,N-diethyl-1-[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 16791138 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N,N-diethyl-1-[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H19F3N2O/c1-3-18(4-2)12(9-17)10-5-7-11(8-6-10)19-13(14,15)16/h5-8,12H,3-4,9,17H2,1-2H3 |
| InChIKey | MDFBKVRNXNPMBI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |