C14H26N2O3 — CID 167911387
1-[(3-ethoxycyclobutyl)methyl]-2-(methoxymethyl)pyrrolidine-2-carboxamide (PubChem CID 167911387) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-[(3-ethoxycyclobutyl)methyl]-2-(methoxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[(3-ethoxycyclobutyl)methyl]-2-(methoxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 167911387 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-[(3-ethoxycyclobutyl)methyl]-2-(methoxymethyl)pyrrolidine-2-carboxamide |
| SMILES | CCOC1CC(CN2CCCC2(COC)C(N)=O)C1 |
| InChI | InChI=1S/C14H26N2O3/c1-3-19-12-7-11(8-12)9-16-6-4-5-14(16,10-18-2)13(15)17/h11-12H,3-10H2,1-2H3,(H2,15,17) |
| InChIKey | CZOMCTKOWGJKSZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |