C17H19ClFN3O5 — CID 167911583
2-[8-[(4-chloro-2-fluoro-5-methoxyphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetic acid (PubChem CID 167911583) has the molecular formula C17H19ClFN3O5 and a molecular weight of 399.81 g/mol. Its IUPAC name is 2-[8-[(4-chloro-2-fluoro-5-methoxyphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetic acid.
| Compound Name | 2-[8-[(4-chloro-2-fluoro-5-methoxyphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetic acid |
|---|---|
| PubChem CID | 167911583 |
| Molecular Formula | C17H19ClFN3O5 |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[8-[(4-chloro-2-fluoro-5-methoxyphenyl)methyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl]acetic acid |
| SMILES | COc1cc(CN2CCC3(CC2)NC(=O)N(CC(=O)O)C3=O)c(F)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3O5/c1-27-13-6-10(12(19)7-11(13)18)8-21-4-2-17(3-5-21)15(25)22(9-14(23)24)16(26)20-17/h6-7H,2-5,8-9H2,1H3,(H,20,26)(H,23,24) |
| InChIKey | ZNCPPDDSUFGMTB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|