About 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine
5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine (PubChem CID 167911993) has the molecular formula C16H17NO5S
and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine.
Molecular Properties
| Compound Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine |
| PubChem CID | 167911993 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine |
| SMILES | COc1ccc(CS(=O)(=O)c2ccc3c(c2)OCCCO3)cn1 |
| InChI | InChI=1S/C16H17NO5S/c1-20-16-6-3-12(10-17-16)11-23(18,19)13-4-5-14-15(9-13)22-8-2-7-21-14/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChIKey | JJFWYDIOUWNZCA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine?
The IUPAC name of 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine (CID 167911993) is 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine.
What is the SMILES notation for 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine?
The canonical SMILES for 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine is COc1ccc(CS(=O)(=O)c2ccc3c(c2)OCCCO3)cn1.
What is the InChIKey of 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine?
The InChIKey is JJFWYDIOUWNZCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO5S/c1-20-16-6-3-12(10-17-16)11-23(18,19)13-4-5-14-15(9-13)22-8-2-7-21-14/h3-6,9-10H,2,7-8,11H2,1H3.
What are the key properties of 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine?
5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine has a molecular weight of 335.38 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylmethyl)-2-methoxypyridine is sourced from PubChem (CID 167911993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).