C17H16N2O6 — CID 167912394
methyl 5-[(2-hydroxy-4-nitrobenzoyl)amino]-2,4-dimethylbenzoate (PubChem CID 167912394) has the molecular formula C17H16N2O6 and a molecular weight of 344.32 g/mol. Its IUPAC name is methyl 5-[(2-hydroxy-4-nitrobenzoyl)amino]-2,4-dimethylbenzoate.
| Compound Name | methyl 5-[(2-hydroxy-4-nitrobenzoyl)amino]-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 167912394 |
| Molecular Formula | C17H16N2O6 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | methyl 5-[(2-hydroxy-4-nitrobenzoyl)amino]-2,4-dimethylbenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc([N+](=O)[O-])cc2O)c(C)cc1C |
| InChI | InChI=1S/C17H16N2O6/c1-9-6-10(2)14(8-13(9)17(22)25-3)18-16(21)12-5-4-11(19(23)24)7-15(12)20/h4-8,20H,1-3H3,(H,18,21) |
| InChIKey | HJQYNIQWRCMLIO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|