C13H19N5O2S — CID 167913436
N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl]-1-methylimidazo[4,5-c]pyridin-2-amine (PubChem CID 167913436) has the molecular formula C13H19N5O2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl]-1-methylimidazo[4,5-c]pyridin-2-amine.
| Compound Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl]-1-methylimidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 167913436 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)propyl]-1-methylimidazo[4,5-c]pyridin-2-amine |
| SMILES | Cn1c(NCCCN2CCCS2(=O)=O)nc2cnccc21 |
| InChI | InChI=1S/C13H19N5O2S/c1-17-12-4-6-14-10-11(12)16-13(17)15-5-2-7-18-8-3-9-21(18,19)20/h4,6,10H,2-3,5,7-9H2,1H3,(H,15,16) |
| InChIKey | RWZHUNNXBGGVAV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|