C18H19N3O2S — CID 167913987
1-[2-methyl-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 167913987) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[2-methyl-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-methyl-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167913987 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1-[2-methyl-5-(4,5,6,7-tetrahydrothieno[3,2-c]pyridin-2-yl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | Cc1ccc(-c2cc3c(s2)CCNC3)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H19N3O2S/c1-11-2-3-12(16-9-13-10-19-6-4-15(13)24-16)8-14(11)21-7-5-17(22)20-18(21)23/h2-3,8-9,19H,4-7,10H2,1H3,(H,20,22,23) |
| InChIKey | ITEWJPYYMPMETN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |