About [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate
[4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate (PubChem CID 167914291) has the molecular formula C13H11N5O2
and a molecular weight of 269.26 g/mol. Its IUPAC name is [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate |
| PubChem CID | 167914291 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)Oc2ccc(-n3ccnn3)cc2)cn1 |
| InChI | InChI=1S/C13H11N5O2/c1-17-9-10(8-15-17)13(19)20-12-4-2-11(3-5-12)18-7-6-14-16-18/h2-9H,1H3 |
| InChIKey | HGRLULNKJKBZNT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate?
The IUPAC name of [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate (CID 167914291) is [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate.
What is the SMILES notation for [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate?
The canonical SMILES for [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate is Cn1cc(C(=O)Oc2ccc(-n3ccnn3)cc2)cn1.
What is the InChIKey of [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate?
The InChIKey is HGRLULNKJKBZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O2/c1-17-9-10(8-15-17)13(19)20-12-4-2-11(3-5-12)18-7-6-14-16-18/h2-9H,1H3.
What are the key properties of [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate?
[4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate has a molecular weight of 269.26 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(triazol-1-yl)phenyl] 1-methylpyrazole-4-carboxylate is sourced from PubChem (CID 167914291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).