About 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone
1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone (PubChem CID 167914587) has the molecular formula C14H15ClN4O2
and a molecular weight of 306.75 g/mol. Its IUPAC name is 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone |
| PubChem CID | 167914587 |
| Molecular Formula | C14H15ClN4O2 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCN(c2cc(Cl)c3cccnc3n2)CC1 |
| InChI | InChI=1S/C14H15ClN4O2/c15-11-8-12(17-14-10(11)2-1-3-16-14)18-4-6-19(7-5-18)13(21)9-20/h1-3,8,20H,4-7,9H2 |
| InChIKey | GMVASAMIFUOKMF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone?
The IUPAC name of 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone (CID 167914587) is 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone.
What is the SMILES notation for 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone?
The canonical SMILES for 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone is O=C(CO)N1CCN(c2cc(Cl)c3cccnc3n2)CC1.
What is the InChIKey of 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone?
The InChIKey is GMVASAMIFUOKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN4O2/c15-11-8-12(17-14-10(11)2-1-3-16-14)18-4-6-19(7-5-18)13(21)9-20/h1-3,8,20H,4-7,9H2.
What are the key properties of 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone?
1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone has a molecular weight of 306.75 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-chloro-1,8-naphthyridin-2-yl)piperazin-1-yl]-2-hydroxyethanone is sourced from PubChem (CID 167914587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).