C21H25F3N2O6 — CID 167914916
1-[[3-(morpholin-4-ylmethyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 167914916) has the molecular formula C21H25F3N2O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is 1-[[3-(morpholin-4-ylmethyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[[3-(morpholin-4-ylmethyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167914916 |
| Molecular Formula | C21H25F3N2O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-[[3-(morpholin-4-ylmethyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C1(C(=O)Nc2cccc(CN3CCOCC3)c2)CC=CCC1 |
| InChI | InChI=1S/C19H24N2O4.C2HF3O2/c22-17(19(18(23)24)7-2-1-3-8-19)20-16-6-4-5-15(13-16)14-21-9-11-25-12-10-21;3-2(4,5)1(6)7/h1-2,4-6,13H,3,7-12,14H2,(H,20,22)(H,23,24);(H,6,7) |
| InChIKey | JBSXIGXZQOADIJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|