3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid

C8H13F3N2O3 — CID 16791499

IUPAC3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid
SMILESCC(C)C(NC(=O)NCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H13F3N2O3/c1-4(2)5(6(14)15)13-7(16)12-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,14,15)(H2,12,13,16)
InChIKeyRKMTWOFQOQVGFW-UHFFFAOYSA-N
MW242.20 g/mol
LogP0.96
Rot. Bonds4

About 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid

3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid (PubChem CID 16791499) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid.

Molecular Properties

Compound Name3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid
PubChem CID16791499
Molecular FormulaC8H13F3N2O3
Molecular Weight242.20 g/mol
Exact Mass242.09
IUPAC Name3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid
SMILESCC(C)C(NC(=O)NCC(F)(F)F)C(=O)O
InChIInChI=1S/C8H13F3N2O3/c1-4(2)5(6(14)15)13-7(16)12-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,14,15)(H2,12,13,16)
InChIKeyRKMTWOFQOQVGFW-UHFFFAOYSA-N
XLogP0.96
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.20
LogP ≤ 50.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid?
The IUPAC name of 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid (CID 16791499) is 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid.
What is the SMILES notation for 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid?
The canonical SMILES for 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid is CC(C)C(NC(=O)NCC(F)(F)F)C(=O)O.
What is the InChIKey of 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid?
The InChIKey is RKMTWOFQOQVGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2O3/c1-4(2)5(6(14)15)13-7(16)12-3-8(9,10)11/h4-5H,3H2,1-2H3,(H,14,15)(H2,12,13,16).
What are the key properties of 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid?
3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid has a molecular weight of 242.20 g/mol, XLogP of 0.96, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid is sourced from PubChem (CID 16791499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).