About 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine
4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine (PubChem CID 167916205) has the molecular formula C15H22F2N4
and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine.
Molecular Properties
| Compound Name | 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine |
| PubChem CID | 167916205 |
| Molecular Formula | C15H22F2N4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine |
| SMILES | FC1(F)CC2(CC(c3cn(CC4CCNCC4)nn3)C2)C1 |
| InChI | InChI=1S/C15H22F2N4/c16-15(17)9-14(10-15)5-12(6-14)13-8-21(20-19-13)7-11-1-3-18-4-2-11/h8,11-12,18H,1-7,9-10H2 |
| InChIKey | BFNCJSIDNMSUAA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine?
The IUPAC name of 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine (CID 167916205) is 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine.
What is the SMILES notation for 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine?
The canonical SMILES for 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine is FC1(F)CC2(CC(c3cn(CC4CCNCC4)nn3)C2)C1.
What is the InChIKey of 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine?
The InChIKey is BFNCJSIDNMSUAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N4/c16-15(17)9-14(10-15)5-12(6-14)13-8-21(20-19-13)7-11-1-3-18-4-2-11/h8,11-12,18H,1-7,9-10H2.
What are the key properties of 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine?
4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine has a molecular weight of 296.37 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,2-difluorospiro[3.3]heptan-6-yl)triazol-1-yl]methyl]piperidine is sourced from PubChem (CID 167916205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).