C18H22N4O4 — CID 167916355
3-[(3aS,6aR)-2-(3-oxocyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-6-methyl-1H-pyridazin-4-one (PubChem CID 167916355) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[(3aS,6aR)-2-(3-oxocyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-6-methyl-1H-pyridazin-4-one.
| Compound Name | 3-[(3aS,6aR)-2-(3-oxocyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-6-methyl-1H-pyridazin-4-one |
|---|---|
| PubChem CID | 167916355 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[(3aS,6aR)-2-(3-oxocyclopentanecarbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-6-methyl-1H-pyridazin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2C[C@@H]3CN(C(=O)C4CCC(=O)C4)C[C@@H]3C2)n[nH]1 |
| InChI | InChI=1S/C18H22N4O4/c1-10-4-15(24)16(20-19-10)18(26)22-8-12-6-21(7-13(12)9-22)17(25)11-2-3-14(23)5-11/h4,11-13H,2-3,5-9H2,1H3,(H,19,24)/t11?,12-,13+ |
| InChIKey | RECQVCQOAHOYGN-YHWZYXNKSA-N |
| XLogP | -0.02 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |