C14H13NO4S — CID 16791755
5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-methylthiophene-2-carboxylic acid (PubChem CID 16791755) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 16791755 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(N2C(=O)C3CC=CCC3C2=O)sc1C(=O)O |
| InChI | InChI=1S/C14H13NO4S/c1-7-6-10(20-11(7)14(18)19)15-12(16)8-4-2-3-5-9(8)13(15)17/h2-3,6,8-9H,4-5H2,1H3,(H,18,19) |
| InChIKey | NJBFWQHKCTVLNG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|