C16H20N2O3S — CID 167917867
3-[(2-methoxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 167917867) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 3-[(2-methoxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 167917867 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 3-[(2-methoxyphenyl)methylamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(NCc2ccccc2OC)c1C |
| InChI | InChI=1S/C16H20N2O3S/c1-12-14(8-6-10-16(12)22(19,20)17-2)18-11-13-7-4-5-9-15(13)21-3/h4-10,17-18H,11H2,1-3H3 |
| InChIKey | VTEHFRNAXBHWLL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |