C20H28N4O — CID 167918172
7-[5-(2-methoxyethyl)-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 167918172) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 7-[5-(2-methoxyethyl)-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 7-[5-(2-methoxyethyl)-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 167918172 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 7-[5-(2-methoxyethyl)-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | COCCc1nc(C2CCN3CCCC3C2)n(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C20H28N4O/c1-15-5-7-17(8-6-15)24-20(21-19(22-24)10-13-25-2)16-9-12-23-11-3-4-18(23)14-16/h5-8,16,18H,3-4,9-14H2,1-2H3 |
| InChIKey | CWHNRVZBRUGQEQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |