About 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea
1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea (PubChem CID 167918374) has the molecular formula C11H16F2N4O3
and a molecular weight of 290.27 g/mol. Its IUPAC name is 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea |
| PubChem CID | 167918374 |
| Molecular Formula | C11H16F2N4O3 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea |
| SMILES | Cn1cc(NC(=O)NCC2CCOCO2)c(C(F)F)n1 |
| InChI | InChI=1S/C11H16F2N4O3/c1-17-5-8(9(16-17)10(12)13)15-11(18)14-4-7-2-3-19-6-20-7/h5,7,10H,2-4,6H2,1H3,(H2,14,15,18) |
| InChIKey | UZJUVEPRZCXKRX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea?
The IUPAC name of 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea (CID 167918374) is 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea.
What is the SMILES notation for 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea?
The canonical SMILES for 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea is Cn1cc(NC(=O)NCC2CCOCO2)c(C(F)F)n1.
What is the InChIKey of 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea?
The InChIKey is UZJUVEPRZCXKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N4O3/c1-17-5-8(9(16-17)10(12)13)15-11(18)14-4-7-2-3-19-6-20-7/h5,7,10H,2-4,6H2,1H3,(H2,14,15,18).
What are the key properties of 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea?
1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea has a molecular weight of 290.27 g/mol, XLogP of 1.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(difluoromethyl)-1-methylpyrazol-4-yl]-3-(1,3-dioxan-4-ylmethyl)urea is sourced from PubChem (CID 167918374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).