C15H16F3N5O2 — CID 167919378
N-(1-ethylpyrazol-4-yl)-N'-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide (PubChem CID 167919378) has the molecular formula C15H16F3N5O2 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-N'-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-N'-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide |
|---|---|
| PubChem CID | 167919378 |
| Molecular Formula | C15H16F3N5O2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-N'-[(1S)-1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]oxamide |
| SMILES | CCn1cc(NC(=O)C(=O)N[C@@H](C)c2ccc(C(F)(F)F)nc2)cn1 |
| InChI | InChI=1S/C15H16F3N5O2/c1-3-23-8-11(7-20-23)22-14(25)13(24)21-9(2)10-4-5-12(19-6-10)15(16,17)18/h4-9H,3H2,1-2H3,(H,21,24)(H,22,25)/t9-/m0/s1 |
| InChIKey | UMLNZWDYPWOEPO-VIFPVBQESA-N |
| XLogP | 2.13 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|