About 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole
5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole (PubChem CID 167919809) has the molecular formula C15H11N5O
and a molecular weight of 277.29 g/mol. Its IUPAC name is 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole |
| PubChem CID | 167919809 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole |
| SMILES | c1ccc(-c2nccn2Cc2ccc3nonc3c2)nc1 |
| InChI | InChI=1S/C15H11N5O/c1-2-6-16-13(3-1)15-17-7-8-20(15)10-11-4-5-12-14(9-11)19-21-18-12/h1-9H,10H2 |
| InChIKey | XYSJSWQQTBOZDT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole?
The IUPAC name of 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole (CID 167919809) is 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole?
The canonical SMILES for 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole is c1ccc(-c2nccn2Cc2ccc3nonc3c2)nc1.
What is the InChIKey of 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole?
The InChIKey is XYSJSWQQTBOZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5O/c1-2-6-16-13(3-1)15-17-7-8-20(15)10-11-4-5-12-14(9-11)19-21-18-12/h1-9H,10H2.
What are the key properties of 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole?
5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole has a molecular weight of 277.29 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-pyridin-2-ylimidazol-1-yl)methyl]-2,1,3-benzoxadiazole is sourced from PubChem (CID 167919809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).