About 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide
5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide (PubChem CID 167920553) has the molecular formula C13H12Cl2N4O2S
and a molecular weight of 359.24 g/mol. Its IUPAC name is 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide |
| PubChem CID | 167920553 |
| Molecular Formula | C13H12Cl2N4O2S |
| Molecular Weight | 359.24 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1NS(=O)(=O)c1c[nH]c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C13H12Cl2N4O2S/c1-6-13(7(2)18-17-6)19-22(20,21)12-5-16-11-4-10(15)9(14)3-8(11)12/h3-5,16,19H,1-2H3,(H,17,18) |
| InChIKey | WLQOHWSIEABSES-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.24 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide?
The IUPAC name of 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide (CID 167920553) is 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide?
The canonical SMILES for 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide is Cc1n[nH]c(C)c1NS(=O)(=O)c1c[nH]c2cc(Cl)c(Cl)cc12.
What is the InChIKey of 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide?
The InChIKey is WLQOHWSIEABSES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N4O2S/c1-6-13(7(2)18-17-6)19-22(20,21)12-5-16-11-4-10(15)9(14)3-8(11)12/h3-5,16,19H,1-2H3,(H,17,18).
What are the key properties of 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide?
5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide has a molecular weight of 359.24 g/mol, XLogP of 3.62, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-N-(3,5-dimethyl-1H-pyrazol-4-yl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 167920553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).