C21H22F3NO6 — CID 167920971
3-amino-2-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167920971) has the molecular formula C21H22F3NO6 and a molecular weight of 441.40 g/mol. Its IUPAC name is 3-amino-2-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-amino-2-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167920971 |
| Molecular Formula | C21H22F3NO6 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 3-amino-2-methyl-5-[2-(oxolan-3-ylmethoxy)phenyl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(N)cc(-c2ccccc2OCC2CCOC2)cc1C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21NO4.C2HF3O2/c1-12-16(19(21)22)8-14(9-17(12)20)15-4-2-3-5-18(15)24-11-13-6-7-23-10-13;3-2(4,5)1(6)7/h2-5,8-9,13H,6-7,10-11,20H2,1H3,(H,21,22);(H,6,7) |
| InChIKey | CSYPKPZJRRFGGX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|