About 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid
3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid (PubChem CID 167921639) has the molecular formula C13H19N5O4S
and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid |
| PubChem CID | 167921639 |
| Molecular Formula | C13H19N5O4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid |
| SMILES | CCn1cnc(S(=O)(=O)NC(Cc2cnn(C)c2C)C(=O)O)c1 |
| InChI | InChI=1S/C13H19N5O4S/c1-4-18-7-12(14-8-18)23(21,22)16-11(13(19)20)5-10-6-15-17(3)9(10)2/h6-8,11,16H,4-5H2,1-3H3,(H,19,20) |
| InChIKey | IBMRJEAFEOJQSG-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid?
The IUPAC name of 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid (CID 167921639) is 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid.
What is the SMILES notation for 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid?
The canonical SMILES for 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid is CCn1cnc(S(=O)(=O)NC(Cc2cnn(C)c2C)C(=O)O)c1.
What is the InChIKey of 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid?
The InChIKey is IBMRJEAFEOJQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N5O4S/c1-4-18-7-12(14-8-18)23(21,22)16-11(13(19)20)5-10-6-15-17(3)9(10)2/h6-8,11,16H,4-5H2,1-3H3,(H,19,20).
What are the key properties of 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid?
3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid has a molecular weight of 341.39 g/mol, XLogP of -0.08, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,5-dimethylpyrazol-4-yl)-2-[(1-ethylimidazol-4-yl)sulfonylamino]propanoic acid is sourced from PubChem (CID 167921639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).