C22H23N5O2 — CID 167923159
[2-(1-but-3-enyltriazol-4-yl)morpholin-4-yl]-(5-phenyl-2-pyridinyl)methanone (PubChem CID 167923159) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is [2-(1-but-3-enyltriazol-4-yl)morpholin-4-yl]-(5-phenyl-2-pyridinyl)methanone.
| Compound Name | [2-(1-but-3-enyltriazol-4-yl)morpholin-4-yl]-(5-phenyl-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 167923159 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [2-(1-but-3-enyltriazol-4-yl)morpholin-4-yl]-(5-phenyl-2-pyridinyl)methanone |
| SMILES | C=CCCn1cc(C2CN(C(=O)c3ccc(-c4ccccc4)cn3)CCO2)nn1 |
| InChI | InChI=1S/C22H23N5O2/c1-2-3-11-27-15-20(24-25-27)21-16-26(12-13-29-21)22(28)19-10-9-18(14-23-19)17-7-5-4-6-8-17/h2,4-10,14-15,21H,1,3,11-13,16H2 |
| InChIKey | CMWSKAZNEXCOEO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|