C10H14F3NO3 — CID 167923288
3,3,3-trifluoro-2-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylpropanamide (PubChem CID 167923288) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylpropanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 167923288 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-N-[(1S,4R)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-2-methylpropanamide |
| SMILES | CC(O)(C(=O)N[C@@H]1C=C[C@H](CO)C1)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO3/c1-9(17,10(11,12)13)8(16)14-7-3-2-6(4-7)5-15/h2-3,6-7,15,17H,4-5H2,1H3,(H,14,16)/t6-,7+,9?/m0/s1 |
| InChIKey | SOMYYRVETOLWOR-PMDVUHRTSA-N |
| XLogP | 0.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|