C15H15N5O2S — CID 167923716
1-[2-(4-cyanophenoxy)ethyl]-3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 167923716) has the molecular formula C15H15N5O2S and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[2-(4-cyanophenoxy)ethyl]-3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-[2-(4-cyanophenoxy)ethyl]-3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 167923716 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 1-[2-(4-cyanophenoxy)ethyl]-3-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | N#Cc1ccc(OCCNC(=O)Nc2nnc(C3CC3)s2)cc1 |
| InChI | InChI=1S/C15H15N5O2S/c16-9-10-1-5-12(6-2-10)22-8-7-17-14(21)18-15-20-19-13(23-15)11-3-4-11/h1-2,5-6,11H,3-4,7-8H2,(H2,17,18,20,21) |
| InChIKey | KMSNZZSRXZMIEH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|