About cyclopropanecarbonyl isothiocyanate
cyclopropanecarbonyl isothiocyanate (PubChem CID 16792372) has the molecular formula C5H5NOS
and a molecular weight of 127.17 g/mol. Its IUPAC name is cyclopropanecarbonyl isothiocyanate.
Molecular Properties
| Compound Name | cyclopropanecarbonyl isothiocyanate |
| PubChem CID | 16792372 |
| Molecular Formula | C5H5NOS |
| Molecular Weight | 127.17 g/mol |
| Exact Mass | 127.01 |
| IUPAC Name | cyclopropanecarbonyl isothiocyanate |
| SMILES | O=C(N=C=S)C1CC1 |
| InChI | InChI=1S/C5H5NOS/c7-5(6-3-8)4-1-2-4/h4H,1-2H2 |
| InChIKey | BGNLTOFAQVNXMQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanecarbonyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarbonyl isothiocyanate?
The IUPAC name of cyclopropanecarbonyl isothiocyanate (CID 16792372) is cyclopropanecarbonyl isothiocyanate.
What is the SMILES notation for cyclopropanecarbonyl isothiocyanate?
The canonical SMILES for cyclopropanecarbonyl isothiocyanate is O=C(N=C=S)C1CC1.
What is the InChIKey of cyclopropanecarbonyl isothiocyanate?
The InChIKey is BGNLTOFAQVNXMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS/c7-5(6-3-8)4-1-2-4/h4H,1-2H2.
What are the key properties of cyclopropanecarbonyl isothiocyanate?
cyclopropanecarbonyl isothiocyanate has a molecular weight of 127.17 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarbonyl isothiocyanate is sourced from PubChem (CID 16792372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).