About 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea
1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea (PubChem CID 167924029) has the molecular formula C13H22N6O2
and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea |
| PubChem CID | 167924029 |
| Molecular Formula | C13H22N6O2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea |
| SMILES | CCn1nnnc1NC(=O)NC1CC2(COC(C)(C)C2)C1 |
| InChI | InChI=1S/C13H22N6O2/c1-4-19-10(16-17-18-19)15-11(20)14-9-5-13(6-9)7-12(2,3)21-8-13/h9H,4-8H2,1-3H3,(H2,14,15,16,18,20) |
| InChIKey | TXRPNCKQIBEBHP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea?
The IUPAC name of 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea (CID 167924029) is 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea.
What is the SMILES notation for 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea?
The canonical SMILES for 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea is CCn1nnnc1NC(=O)NC1CC2(COC(C)(C)C2)C1.
What is the InChIKey of 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea?
The InChIKey is TXRPNCKQIBEBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N6O2/c1-4-19-10(16-17-18-19)15-11(20)14-9-5-13(6-9)7-12(2,3)21-8-13/h9H,4-8H2,1-3H3,(H2,14,15,16,18,20).
What are the key properties of 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea?
1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea has a molecular weight of 294.36 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7,7-dimethyl-6-oxaspiro[3.4]octan-2-yl)-3-(1-ethyltetrazol-5-yl)urea is sourced from PubChem (CID 167924029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).