About 6,7-dimethyl-2,3-dihydro-1H-indole
6,7-dimethyl-2,3-dihydro-1H-indole (PubChem CID 16792444) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 6,7-dimethyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 6,7-dimethyl-2,3-dihydro-1H-indole |
| PubChem CID | 16792444 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6,7-dimethyl-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc2c(c1C)NCC2 |
| InChI | InChI=1S/C10H13N/c1-7-3-4-9-5-6-11-10(9)8(7)2/h3-4,11H,5-6H2,1-2H3 |
| InChIKey | JKCVBHBAFRJIKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,7-dimethyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-2,3-dihydro-1H-indole?
The IUPAC name of 6,7-dimethyl-2,3-dihydro-1H-indole (CID 16792444) is 6,7-dimethyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 6,7-dimethyl-2,3-dihydro-1H-indole?
The canonical SMILES for 6,7-dimethyl-2,3-dihydro-1H-indole is Cc1ccc2c(c1C)NCC2.
What is the InChIKey of 6,7-dimethyl-2,3-dihydro-1H-indole?
The InChIKey is JKCVBHBAFRJIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-7-3-4-9-5-6-11-10(9)8(7)2/h3-4,11H,5-6H2,1-2H3.
What are the key properties of 6,7-dimethyl-2,3-dihydro-1H-indole?
6,7-dimethyl-2,3-dihydro-1H-indole has a molecular weight of 147.22 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 16792444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).