About 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea
1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea (PubChem CID 167925516) has the molecular formula C19H24N4O
and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea |
| PubChem CID | 167925516 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea |
| SMILES | CC1C(NC(=O)Nc2ccnc(-c3ccccc3)c2)CCCN1C |
| InChI | InChI=1S/C19H24N4O/c1-14-17(9-6-12-23(14)2)22-19(24)21-16-10-11-20-18(13-16)15-7-4-3-5-8-15/h3-5,7-8,10-11,13-14,17H,6,9,12H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | OEFFYLYXKFJTBE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea?
The IUPAC name of 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea (CID 167925516) is 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea.
What is the SMILES notation for 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea?
The canonical SMILES for 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea is CC1C(NC(=O)Nc2ccnc(-c3ccccc3)c2)CCCN1C.
What is the InChIKey of 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea?
The InChIKey is OEFFYLYXKFJTBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O/c1-14-17(9-6-12-23(14)2)22-19(24)21-16-10-11-20-18(13-16)15-7-4-3-5-8-15/h3-5,7-8,10-11,13-14,17H,6,9,12H2,1-2H3,(H2,20,21,22,24).
What are the key properties of 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea?
1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea has a molecular weight of 324.43 g/mol, XLogP of 3.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dimethylpiperidin-3-yl)-3-(2-phenyl-4-pyridinyl)urea is sourced from PubChem (CID 167925516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).