C9H11ClF4N2O2S — CID 167926280
5-chloro-1,3-dimethyl-4-(3,3,4,4-tetrafluorobutylsulfonyl)pyrazole (PubChem CID 167926280) has the molecular formula C9H11ClF4N2O2S and a molecular weight of 322.71 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-4-(3,3,4,4-tetrafluorobutylsulfonyl)pyrazole.
| Compound Name | 5-chloro-1,3-dimethyl-4-(3,3,4,4-tetrafluorobutylsulfonyl)pyrazole |
|---|---|
| PubChem CID | 167926280 |
| Molecular Formula | C9H11ClF4N2O2S |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 5-chloro-1,3-dimethyl-4-(3,3,4,4-tetrafluorobutylsulfonyl)pyrazole |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)CCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H11ClF4N2O2S/c1-5-6(7(10)16(2)15-5)19(17,18)4-3-9(13,14)8(11)12/h8H,3-4H2,1-2H3 |
| InChIKey | ZDJYXBUJVUJKOX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|