C19H23N3O2 — CID 167926953
3-cyclobutyl-N-(3-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide (PubChem CID 167926953) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-cyclobutyl-N-(3-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3-cyclobutyl-N-(3-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 167926953 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-cyclobutyl-N-(3-piperidin-1-ylphenyl)-1,2-oxazole-4-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCCC2)c1)c1conc1C1CCC1 |
| InChI | InChI=1S/C19H23N3O2/c23-19(17-13-24-21-18(17)14-6-4-7-14)20-15-8-5-9-16(12-15)22-10-2-1-3-11-22/h5,8-9,12-14H,1-4,6-7,10-11H2,(H,20,23) |
| InChIKey | VEAVRYHNHXPDDW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |