C10H7ClF3N3O — CID 167927042
2-chloro-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-fluoroacetamide (PubChem CID 167927042) has the molecular formula C10H7ClF3N3O and a molecular weight of 277.63 g/mol. Its IUPAC name is 2-chloro-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-fluoroacetamide.
| Compound Name | 2-chloro-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 167927042 |
| Molecular Formula | C10H7ClF3N3O |
| Molecular Weight | 277.63 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-chloro-N-[(4,5-difluoro-1H-benzimidazol-2-yl)methyl]-2-fluoroacetamide |
| SMILES | O=C(NCc1nc2c(F)c(F)ccc2[nH]1)C(F)Cl |
| InChI | InChI=1S/C10H7ClF3N3O/c11-9(14)10(18)15-3-6-16-5-2-1-4(12)7(13)8(5)17-6/h1-2,9H,3H2,(H,15,18)(H,16,17) |
| InChIKey | FRVMHIKGXUCWDD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.63 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|