About 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide
4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide (PubChem CID 167927226) has the molecular formula C14H11ClF2N2O2
and a molecular weight of 312.70 g/mol. Its IUPAC name is 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide |
| PubChem CID | 167927226 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide |
| SMILES | O=C(NCc1cnoc1C1CC1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H11ClF2N2O2/c15-10-4-11(16)9(3-12(10)17)14(20)18-5-8-6-19-21-13(8)7-1-2-7/h3-4,6-7H,1-2,5H2,(H,18,20) |
| InChIKey | DFDVTXYJEUBGNH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide?
The IUPAC name of 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide (CID 167927226) is 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide.
What is the SMILES notation for 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide?
The canonical SMILES for 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide is O=C(NCc1cnoc1C1CC1)c1cc(F)c(Cl)cc1F.
What is the InChIKey of 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide?
The InChIKey is DFDVTXYJEUBGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClF2N2O2/c15-10-4-11(16)9(3-12(10)17)14(20)18-5-8-6-19-21-13(8)7-1-2-7/h3-4,6-7H,1-2,5H2,(H,18,20).
What are the key properties of 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide?
4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide has a molecular weight of 312.70 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(5-cyclopropyl-1,2-oxazol-4-yl)methyl]-2,5-difluorobenzamide is sourced from PubChem (CID 167927226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).