About cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride
cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride (PubChem CID 167927282) has the molecular formula C16H27ClN4O
and a molecular weight of 326.87 g/mol. Its IUPAC name is cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride.
Molecular Properties
| Compound Name | cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride |
| PubChem CID | 167927282 |
| Molecular Formula | C16H27ClN4O |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1ncn(CCC2CCNCC2)n1)C1CCCCC1 |
| InChI | InChI=1S/C16H26N4O.ClH/c21-15(14-4-2-1-3-5-14)16-18-12-20(19-16)11-8-13-6-9-17-10-7-13;/h12-14,17H,1-11H2;1H |
| InChIKey | MHVIYIWIFSEEMD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride?
The IUPAC name of cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride (CID 167927282) is cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride.
What is the SMILES notation for cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride?
The canonical SMILES for cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride is Cl.O=C(c1ncn(CCC2CCNCC2)n1)C1CCCCC1.
What is the InChIKey of cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride?
The InChIKey is MHVIYIWIFSEEMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O.ClH/c21-15(14-4-2-1-3-5-14)16-18-12-20(19-16)11-8-13-6-9-17-10-7-13;/h12-14,17H,1-11H2;1H.
What are the key properties of cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride?
cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride has a molecular weight of 326.87 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[1-(2-piperidin-4-ylethyl)-1,2,4-triazol-3-yl]methanone;hydrochloride is sourced from PubChem (CID 167927282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).