C19H20N2O4 — CID 167927330
2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (PubChem CID 167927330) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid.
| Compound Name | 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
|---|---|
| PubChem CID | 167927330 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| SMILES | COCc1ccc(CN2CCc3[nH]c4ccc(C(=O)O)cc4c3C2)o1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-11-14-4-3-13(25-14)9-21-7-6-18-16(10-21)15-8-12(19(22)23)2-5-17(15)20-18/h2-5,8,20H,6-7,9-11H2,1H3,(H,22,23) |
| InChIKey | GELQPRUFBXJTSO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|