About 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid
3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid (PubChem CID 167927597) has the molecular formula C16H15Cl2NO3
and a molecular weight of 340.21 g/mol. Its IUPAC name is 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid |
| PubChem CID | 167927597 |
| Molecular Formula | C16H15Cl2NO3 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(NCc2ccc(-c3cc(Cl)ccc3Cl)o2)C1 |
| InChI | InChI=1S/C16H15Cl2NO3/c17-10-1-3-14(18)13(7-10)15-4-2-12(22-15)8-19-11-5-9(6-11)16(20)21/h1-4,7,9,11,19H,5-6,8H2,(H,20,21) |
| InChIKey | NTCOWJUZJYLAEQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid?
The IUPAC name of 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid (CID 167927597) is 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid.
What is the SMILES notation for 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid?
The canonical SMILES for 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid is O=C(O)C1CC(NCc2ccc(-c3cc(Cl)ccc3Cl)o2)C1.
What is the InChIKey of 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid?
The InChIKey is NTCOWJUZJYLAEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO3/c17-10-1-3-14(18)13(7-10)15-4-2-12(22-15)8-19-11-5-9(6-11)16(20)21/h1-4,7,9,11,19H,5-6,8H2,(H,20,21).
What are the key properties of 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid?
3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid has a molecular weight of 340.21 g/mol, XLogP of 4.21, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]cyclobutane-1-carboxylic acid is sourced from PubChem (CID 167927597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).