C27H22N6O4S — CID 167928345
N-[2-hydroxy-4-(2H-tetrazol-5-yl)phenyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 167928345) has the molecular formula C27H22N6O4S and a molecular weight of 526.58 g/mol. Its IUPAC name is N-[2-hydroxy-4-(2H-tetrazol-5-yl)phenyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[2-hydroxy-4-(2H-tetrazol-5-yl)phenyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167928345 |
| Molecular Formula | C27H22N6O4S |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[2-hydroxy-4-(2H-tetrazol-5-yl)phenyl]-2-naphthalen-2-ylsulfonyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nn[nH]n2)cc1O)C1Cc2ccccc2CN1S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22N6O4S/c34-25-15-20(26-29-31-32-30-26)10-12-23(25)28-27(35)24-14-19-7-3-4-8-21(19)16-33(24)38(36,37)22-11-9-17-5-1-2-6-18(17)13-22/h1-13,15,24,34H,14,16H2,(H,28,35)(H,29,30,31,32) |
| InChIKey | SKPBEAJMXZBCPE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|