C21H17N5O2 — CID 167928589
N-(4-phenyl-1,2,4-triazol-3-yl)-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 167928589) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-(4-phenyl-1,2,4-triazol-3-yl)-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-(4-phenyl-1,2,4-triazol-3-yl)-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 167928589 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(4-phenyl-1,2,4-triazol-3-yl)-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | O=C(Nc1nncn1-c1ccccc1)c1ccc(OCc2ccncc2)cc1 |
| InChI | InChI=1S/C21H17N5O2/c27-20(24-21-25-23-15-26(21)18-4-2-1-3-5-18)17-6-8-19(9-7-17)28-14-16-10-12-22-13-11-16/h1-13,15H,14H2,(H,24,25,27) |
| InChIKey | XCIMICDMVHNJST-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |