6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid

C11H11N3O2 — CID 16792904

IUPAC6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid
SMILESCc1cc(C)n(-c2ccc(C(=O)O)cn2)n1
InChIInChI=1S/C11H11N3O2/c1-7-5-8(2)14(13-7)10-4-3-9(6-12-10)11(15)16/h3-6H,1-2H3,(H,15,16)
InChIKeyOYDQYWLLZLOLAJ-UHFFFAOYSA-N
MW217.23 g/mol
LogP1.58
Rot. Bonds2

About 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid

6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid (PubChem CID 16792904) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid
PubChem CID16792904
Molecular FormulaC11H11N3O2
Molecular Weight217.23 g/mol
Exact Mass217.09
IUPAC Name6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid
SMILESCc1cc(C)n(-c2ccc(C(=O)O)cn2)n1
InChIInChI=1S/C11H11N3O2/c1-7-5-8(2)14(13-7)10-4-3-9(6-12-10)11(15)16/h3-6H,1-2H3,(H,15,16)
InChIKeyOYDQYWLLZLOLAJ-UHFFFAOYSA-N
XLogP1.58
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.23
LogP ≤ 51.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid?
The IUPAC name of 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid (CID 16792904) is 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid.
What is the SMILES notation for 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid?
The canonical SMILES for 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid is Cc1cc(C)n(-c2ccc(C(=O)O)cn2)n1.
What is the InChIKey of 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid?
The InChIKey is OYDQYWLLZLOLAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-7-5-8(2)14(13-7)10-4-3-9(6-12-10)11(15)16/h3-6H,1-2H3,(H,15,16).
What are the key properties of 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid?
6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid has a molecular weight of 217.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxylic acid is sourced from PubChem (CID 16792904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).