About 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one
5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one (PubChem CID 167929077) has the molecular formula C21H16BrClN2O3
and a molecular weight of 459.73 g/mol. Its IUPAC name is 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 167929077 |
| Molecular Formula | C21H16BrClN2O3 |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cccc(NCc3ccccc3Oc3ccc(Cl)cc3Br)c2N1 |
| InChI | InChI=1S/C21H16BrClN2O3/c22-15-10-14(23)8-9-18(15)28-17-6-2-1-4-13(17)11-24-16-5-3-7-19-21(16)25-20(26)12-27-19/h1-10,24H,11-12H2,(H,25,26) |
| InChIKey | PAKPCQUMRYLOOY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one (CID 167929077) is 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one is O=C1COc2cccc(NCc3ccccc3Oc3ccc(Cl)cc3Br)c2N1.
What is the InChIKey of 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one?
The InChIKey is PAKPCQUMRYLOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16BrClN2O3/c22-15-10-14(23)8-9-18(15)28-17-6-2-1-4-13(17)11-24-16-5-3-7-19-21(16)25-20(26)12-27-19/h1-10,24H,11-12H2,(H,25,26).
What are the key properties of 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one?
5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one has a molecular weight of 459.73 g/mol, XLogP of 5.84, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2-(2-bromo-4-chlorophenoxy)phenyl]methylamino]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 167929077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).