C16H21N5OS2 — CID 167930033
(3aS,6aR)-2,3a-dimethyl-N-[3-(3-methylthiophen-2-yl)-1,2,4-thiadiazol-5-yl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 167930033) has the molecular formula C16H21N5OS2 and a molecular weight of 363.51 g/mol. Its IUPAC name is (3aS,6aR)-2,3a-dimethyl-N-[3-(3-methylthiophen-2-yl)-1,2,4-thiadiazol-5-yl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aR)-2,3a-dimethyl-N-[3-(3-methylthiophen-2-yl)-1,2,4-thiadiazol-5-yl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 167930033 |
| Molecular Formula | C16H21N5OS2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (3aS,6aR)-2,3a-dimethyl-N-[3-(3-methylthiophen-2-yl)-1,2,4-thiadiazol-5-yl]-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1ccsc1-c1nsc(NC(=O)N2C[C@H]3CN(C)C[C@@]3(C)C2)n1 |
| InChI | InChI=1S/C16H21N5OS2/c1-10-4-5-23-12(10)13-17-14(24-19-13)18-15(22)21-7-11-6-20(3)8-16(11,2)9-21/h4-5,11H,6-9H2,1-3H3,(H,17,18,19,22)/t11-,16+/m1/s1 |
| InChIKey | NUUZNOVLYXZGBY-BZNIZROVSA-N |
| XLogP | 2.99 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |