C26H26N4O5 — CID 167930482
N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N'-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]oxamide (PubChem CID 167930482) has the molecular formula C26H26N4O5 and a molecular weight of 474.52 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N'-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]oxamide.
| Compound Name | N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N'-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 167930482 |
| Molecular Formula | C26H26N4O5 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]-N'-[4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]oxamide |
| SMILES | COc1cc(OC)cc(C(O)CNC(=O)C(=O)Nc2ccc(-c3cn4cccc(C)c4n3)cc2)c1 |
| InChI | InChI=1S/C26H26N4O5/c1-16-5-4-10-30-15-22(29-24(16)30)17-6-8-19(9-7-17)28-26(33)25(32)27-14-23(31)18-11-20(34-2)13-21(12-18)35-3/h4-13,15,23,31H,14H2,1-3H3,(H,27,32)(H,28,33) |
| InChIKey | VUZFPDMESJFBQT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|