C13H17N3O3S2 — CID 167931389
N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-5-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 167931389) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-5-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-5-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167931389 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)oxyethyl]-5-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1csc2ncnc(NCCOC3CCS(=O)(=O)C3)c12 |
| InChI | InChI=1S/C13H17N3O3S2/c1-9-6-20-13-11(9)12(15-8-16-13)14-3-4-19-10-2-5-21(17,18)7-10/h6,8,10H,2-5,7H2,1H3,(H,14,15,16) |
| InChIKey | WRJAKJCRQDUBOE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|