C15H16Cl2FN3O — CID 167931558
N-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-1-(3,5-dichloro-2-fluorophenyl)ethanamine (PubChem CID 167931558) has the molecular formula C15H16Cl2FN3O and a molecular weight of 344.22 g/mol. Its IUPAC name is N-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-1-(3,5-dichloro-2-fluorophenyl)ethanamine.
| Compound Name | N-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-1-(3,5-dichloro-2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 167931558 |
| Molecular Formula | C15H16Cl2FN3O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[(3-cyclobutyl-1,2,4-oxadiazol-5-yl)methyl]-1-(3,5-dichloro-2-fluorophenyl)ethanamine |
| SMILES | CC(NCc1nc(C2CCC2)no1)c1cc(Cl)cc(Cl)c1F |
| InChI | InChI=1S/C15H16Cl2FN3O/c1-8(11-5-10(16)6-12(17)14(11)18)19-7-13-20-15(21-22-13)9-3-2-4-9/h5-6,8-9,19H,2-4,7H2,1H3 |
| InChIKey | VQBRHCLKHAHLNU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|